About (4-methoxycyclohexyl) 3-acetyl-2-phenyl-3,4-dihydropyrazole-5-carboxylate
(4-methoxycyclohexyl) 3-acetyl-2-phenyl-3,4-dihydropyrazole-5-carboxylate (PubChem CID 102559561) has the molecular formula C19H24N2O4
and a molecular weight of 344.41 g/mol. Its IUPAC name is (4-methoxycyclohexyl) 3-acetyl-2-phenyl-3,4-dihydropyrazole-5-carboxylate.
Molecular Properties
| Compound Name | (4-methoxycyclohexyl) 3-acetyl-2-phenyl-3,4-dihydropyrazole-5-carboxylate |
| PubChem CID | 102559561 |
| Molecular Formula | C19H24N2O4 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.17 |
| IUPAC Name | (4-methoxycyclohexyl) 3-acetyl-2-phenyl-3,4-dihydropyrazole-5-carboxylate |
| SMILES | COC1CCC(OC(=O)C2=NN(c3ccccc3)C(C(C)=O)C2)CC1 |
| InChI | InChI=1S/C19H24N2O4/c1-13(22)18-12-17(20-21(18)14-6-4-3-5-7-14)19(23)25-16-10-8-15(24-2)9-11-16/h3-7,15-16,18H,8-12H2,1-2H3 |
| InChIKey | ZJLGBWPDVVGQQO-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 68.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (4-methoxycyclohexyl) 3-acetyl-2-phenyl-3,4-dihydropyrazole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-methoxycyclohexyl) 3-acetyl-2-phenyl-3,4-dihydropyrazole-5-carboxylate?
The IUPAC name of (4-methoxycyclohexyl) 3-acetyl-2-phenyl-3,4-dihydropyrazole-5-carboxylate (CID 102559561) is (4-methoxycyclohexyl) 3-acetyl-2-phenyl-3,4-dihydropyrazole-5-carboxylate.
What is the SMILES notation for (4-methoxycyclohexyl) 3-acetyl-2-phenyl-3,4-dihydropyrazole-5-carboxylate?
The canonical SMILES for (4-methoxycyclohexyl) 3-acetyl-2-phenyl-3,4-dihydropyrazole-5-carboxylate is COC1CCC(OC(=O)C2=NN(c3ccccc3)C(C(C)=O)C2)CC1.
What is the InChIKey of (4-methoxycyclohexyl) 3-acetyl-2-phenyl-3,4-dihydropyrazole-5-carboxylate?
The InChIKey is ZJLGBWPDVVGQQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H24N2O4/c1-13(22)18-12-17(20-21(18)14-6-4-3-5-7-14)19(23)25-16-10-8-15(24-2)9-11-16/h3-7,15-16,18H,8-12H2,1-2H3.
What are the key properties of (4-methoxycyclohexyl) 3-acetyl-2-phenyl-3,4-dihydropyrazole-5-carboxylate?
(4-methoxycyclohexyl) 3-acetyl-2-phenyl-3,4-dihydropyrazole-5-carboxylate has a molecular weight of 344.41 g/mol, XLogP of 2.71, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (4-methoxycyclohexyl) 3-acetyl-2-phenyl-3,4-dihydropyrazole-5-carboxylate is sourced from PubChem (CID 102559561), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).