C20H31O4- — CID 102571789
(5Z,8Z,10E,14Z)-12,20-dihydroxyicosa-5,8,10,14-tetraenoate (PubChem CID 102571789) has the molecular formula C20H31O4- and a molecular weight of 335.46 g/mol. Its IUPAC name is (5Z,8Z,10E,14Z)-12,20-dihydroxyicosa-5,8,10,14-tetraenoate.
| Compound Name | (5Z,8Z,10E,14Z)-12,20-dihydroxyicosa-5,8,10,14-tetraenoate |
|---|---|
| PubChem CID | 102571789 |
| Molecular Formula | C20H31O4- |
| Molecular Weight | 335.46 g/mol |
| Exact Mass | 335.22 |
| IUPAC Name | (5Z,8Z,10E,14Z)-12,20-dihydroxyicosa-5,8,10,14-tetraenoate |
| SMILES | O=C([O-])CCC/C=C\C/C=C\C=C\C(O)C/C=C\CCCCCO |
| InChI | InChI=1S/C20H32O4/c21-18-14-10-6-5-8-12-16-19(22)15-11-7-3-1-2-4-9-13-17-20(23)24/h2-4,7-8,11-12,15,19,21-22H,1,5-6,9-10,13-14,16-18H2,(H,23,24)/p-1/b4-2-,7-3-,12-8-,15-11+ |
| InChIKey | NUPDGIJXOAHJRW-LNESKJDXSA-M |
| XLogP | 2.83 |
| TPSA | 80.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.46 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|