C29H27NO6 — CID 102572427
(1R,10R,12S,13S,18R,20R)-10-methyl-15-phenyl-20-phenylmethoxy-11,14,16,19-tetraoxa-2-azapentacyclo[10.8.0.02,10.04,9.013,18]icosa-4,6,8-trien-3-one (PubChem CID 102572427) has the molecular formula C29H27NO6 and a molecular weight of 485.54 g/mol. Its IUPAC name is (1R,10R,12S,13S,18R,20R)-10-methyl-15-phenyl-20-phenylmethoxy-11,14,16,19-tetraoxa-2-azapentacyclo[10.8.0.02,10.04,9.013,18]icosa-4,6,8-trien-3-one.
| Compound Name | (1R,10R,12S,13S,18R,20R)-10-methyl-15-phenyl-20-phenylmethoxy-11,14,16,19-tetraoxa-2-azapentacyclo[10.8.0.02,10.04,9.013,18]icosa-4,6,8-trien-3-one |
|---|---|
| PubChem CID | 102572427 |
| Molecular Formula | C29H27NO6 |
| Molecular Weight | 485.54 g/mol |
| Exact Mass | 485.18 |
| IUPAC Name | (1R,10R,12S,13S,18R,20R)-10-methyl-15-phenyl-20-phenylmethoxy-11,14,16,19-tetraoxa-2-azapentacyclo[10.8.0.02,10.04,9.013,18]icosa-4,6,8-trien-3-one |
| SMILES | C[C@]12O[C@@H]3[C@@H]4OC(c5ccccc5)OC[C@H]4O[C@@H](OCc4ccccc4)[C@@H]3N1C(=O)c1ccccc12 |
| InChI | InChI=1S/C29H27NO6/c1-29-21-15-9-8-14-20(21)26(31)30(29)23-25(36-29)24-22(17-33-27(35-24)19-12-6-3-7-13-19)34-28(23)32-16-18-10-4-2-5-11-18/h2-15,22-25,27-28H,16-17H2,1H3/t22-,23-,24-,25+,27?,28-,29-/m1/s1 |
| InChIKey | OKNWANQDIZDUKP-PJSHNUATSA-N |
| XLogP | 4.14 |
| TPSA | 66.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.54 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |