C30H29NO7 — CID 11752650
[(2S,3R)-3-phenyloxiran-2-yl]-[(1S,2S,6R,7R,9R,12R)-12-phenyl-7-phenylmethoxy-3,8,11,13-tetraoxa-5-azatricyclo[7.4.0.02,6]tridecan-5-yl]methanone (PubChem CID 11752650) has the molecular formula C30H29NO7 and a molecular weight of 515.56 g/mol. Its IUPAC name is [(2S,3R)-3-phenyloxiran-2-yl]-[(1S,2S,6R,7R,9R,12R)-12-phenyl-7-phenylmethoxy-3,8,11,13-tetraoxa-5-azatricyclo[7.4.0.02,6]tridecan-5-yl]methanone.
| Compound Name | [(2S,3R)-3-phenyloxiran-2-yl]-[(1S,2S,6R,7R,9R,12R)-12-phenyl-7-phenylmethoxy-3,8,11,13-tetraoxa-5-azatricyclo[7.4.0.02,6]tridecan-5-yl]methanone |
|---|---|
| PubChem CID | 11752650 |
| Molecular Formula | C30H29NO7 |
| Molecular Weight | 515.56 g/mol |
| Exact Mass | 515.19 |
| IUPAC Name | [(2S,3R)-3-phenyloxiran-2-yl]-[(1S,2S,6R,7R,9R,12R)-12-phenyl-7-phenylmethoxy-3,8,11,13-tetraoxa-5-azatricyclo[7.4.0.02,6]tridecan-5-yl]methanone |
| SMILES | O=C([C@H]1O[C@@H]1c1ccccc1)N1CO[C@@H]2[C@@H]3O[C@H](c4ccccc4)OC[C@H]3O[C@@H](OCc3ccccc3)[C@@H]21 |
| InChI | InChI=1S/C30H29NO7/c32-28(27-24(37-27)20-12-6-2-7-13-20)31-18-35-26-23(31)30(33-16-19-10-4-1-5-11-19)36-22-17-34-29(38-25(22)26)21-14-8-3-9-15-21/h1-15,22-27,29-30H,16-18H2/t22-,23-,24-,25-,26+,27+,29-,30-/m1/s1 |
| InChIKey | BDDMWLRIECUREM-ZBFVXPPOSA-N |
| XLogP | 3.74 |
| TPSA | 78.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.56 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|