C18H22O4S — CID 102573435
2,2-dimethyl-5-[(1R,2S)-2-phenylsulfanylcyclohexyl]-1,3-dioxane-4,6-dione (PubChem CID 102573435) has the molecular formula C18H22O4S and a molecular weight of 334.44 g/mol. Its IUPAC name is 2,2-dimethyl-5-[(1R,2S)-2-phenylsulfanylcyclohexyl]-1,3-dioxane-4,6-dione.
| Compound Name | 2,2-dimethyl-5-[(1R,2S)-2-phenylsulfanylcyclohexyl]-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 102573435 |
| Molecular Formula | C18H22O4S |
| Molecular Weight | 334.44 g/mol |
| Exact Mass | 334.12 |
| IUPAC Name | 2,2-dimethyl-5-[(1R,2S)-2-phenylsulfanylcyclohexyl]-1,3-dioxane-4,6-dione |
| SMILES | CC1(C)OC(=O)C([C@H]2CCCC[C@@H]2Sc2ccccc2)C(=O)O1 |
| InChI | InChI=1S/C18H22O4S/c1-18(2)21-16(19)15(17(20)22-18)13-10-6-7-11-14(13)23-12-8-4-3-5-9-12/h3-5,8-9,13-15H,6-7,10-11H2,1-2H3/t13-,14-/m0/s1 |
| InChIKey | QZFCICRENLDLRF-KBPBESRZSA-N |
| XLogP | 3.79 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.44 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|