C22H29BO5 — CID 102575749
(3aS,7aR)-3a-hydroxy-7a-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]-3,4,6,7-tetrahydro-2H-indene-1,5-dione (PubChem CID 102575749) has the molecular formula C22H29BO5 and a molecular weight of 384.28 g/mol. Its IUPAC name is (3aS,7aR)-3a-hydroxy-7a-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]-3,4,6,7-tetrahydro-2H-indene-1,5-dione.
| Compound Name | (3aS,7aR)-3a-hydroxy-7a-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]-3,4,6,7-tetrahydro-2H-indene-1,5-dione |
|---|---|
| PubChem CID | 102575749 |
| Molecular Formula | C22H29BO5 |
| Molecular Weight | 384.28 g/mol |
| Exact Mass | 384.21 |
| IUPAC Name | (3aS,7aR)-3a-hydroxy-7a-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]-3,4,6,7-tetrahydro-2H-indene-1,5-dione |
| SMILES | CC1(C)OB(c2ccc(C[C@]34CCC(=O)C[C@@]3(O)CCC4=O)cc2)OC1(C)C |
| InChI | InChI=1S/C22H29BO5/c1-19(2)20(3,4)28-23(27-19)16-7-5-15(6-8-16)13-21-11-9-17(24)14-22(21,26)12-10-18(21)25/h5-8,26H,9-14H2,1-4H3/t21-,22-/m0/s1 |
| InChIKey | VPYLMVWFUDPRMW-VXKWHMMOSA-N |
| XLogP | 2.36 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.28 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|