C23H31BO5 — CID 154712083
(1S,2R,3aS,7aS)-1-benzoyl-7a-hydroxy-3a-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,2,3,5,6,7-hexahydroinden-4-one (PubChem CID 154712083) has the molecular formula C23H31BO5 and a molecular weight of 398.31 g/mol. Its IUPAC name is (1S,2R,3aS,7aS)-1-benzoyl-7a-hydroxy-3a-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,2,3,5,6,7-hexahydroinden-4-one.
| Compound Name | (1S,2R,3aS,7aS)-1-benzoyl-7a-hydroxy-3a-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,2,3,5,6,7-hexahydroinden-4-one |
|---|---|
| PubChem CID | 154712083 |
| Molecular Formula | C23H31BO5 |
| Molecular Weight | 398.31 g/mol |
| Exact Mass | 398.23 |
| IUPAC Name | (1S,2R,3aS,7aS)-1-benzoyl-7a-hydroxy-3a-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,2,3,5,6,7-hexahydroinden-4-one |
| SMILES | CC1(C)OB([C@@H]2C[C@]3(C)C(=O)CCC[C@]3(O)[C@H]2C(=O)c2ccccc2)OC1(C)C |
| InChI | InChI=1S/C23H31BO5/c1-20(2)21(3,4)29-24(28-20)16-14-22(5)17(25)12-9-13-23(22,27)18(16)19(26)15-10-7-6-8-11-15/h6-8,10-11,16,18,27H,9,12-14H2,1-5H3/t16-,18-,22-,23+/m1/s1 |
| InChIKey | VUPWSFAYEPLYAJ-ZDZLMVPKSA-N |
| XLogP | 3.84 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.31 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|