C21H29BO4 — CID 58154288
1'-hydroxy-1'-methyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)spiro[1H-indene-3,4'-cyclohexane]-2-one (PubChem CID 58154288) has the molecular formula C21H29BO4 and a molecular weight of 356.27 g/mol. Its IUPAC name is 1'-hydroxy-1'-methyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)spiro[1H-indene-3,4'-cyclohexane]-2-one.
| Compound Name | 1'-hydroxy-1'-methyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)spiro[1H-indene-3,4'-cyclohexane]-2-one |
|---|---|
| PubChem CID | 58154288 |
| Molecular Formula | C21H29BO4 |
| Molecular Weight | 356.27 g/mol |
| Exact Mass | 356.22 |
| IUPAC Name | 1'-hydroxy-1'-methyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)spiro[1H-indene-3,4'-cyclohexane]-2-one |
| SMILES | CC1(O)CCC2(CC1)C(=O)Cc1cc(B3OC(C)(C)C(C)(C)O3)ccc12 |
| InChI | InChI=1S/C21H29BO4/c1-18(2)19(3,4)26-22(25-18)15-6-7-16-14(12-15)13-17(23)21(16)10-8-20(5,24)9-11-21/h6-7,12,24H,8-11,13H2,1-5H3 |
| InChIKey | QELMREMMXVHIPB-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.27 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|