C15H18ClN — CID 102577249
6-chloro-1-cyclohexyl-3,4-dihydroisoquinoline (PubChem CID 102577249) has the molecular formula C15H18ClN and a molecular weight of 247.77 g/mol. Its IUPAC name is 6-chloro-1-cyclohexyl-3,4-dihydroisoquinoline.
| Compound Name | 6-chloro-1-cyclohexyl-3,4-dihydroisoquinoline |
|---|---|
| PubChem CID | 102577249 |
| Molecular Formula | C15H18ClN |
| Molecular Weight | 247.77 g/mol |
| Exact Mass | 247.11 |
| IUPAC Name | 6-chloro-1-cyclohexyl-3,4-dihydroisoquinoline |
| SMILES | Clc1ccc2c(c1)CCN=C2C1CCCCC1 |
| InChI | InChI=1S/C15H18ClN/c16-13-6-7-14-12(10-13)8-9-17-15(14)11-4-2-1-3-5-11/h6-7,10-11H,1-5,8-9H2 |
| InChIKey | VXXQWJSLVJEKHT-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.77 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |