C32H30O3 — CID 102579351
ethyl (1R,5R,9E)-9-benzylidene-10-oxo-1,7-diphenylspiro[4.5]dec-3-ene-4-carboxylate (PubChem CID 102579351) has the molecular formula C32H30O3 and a molecular weight of 462.59 g/mol. Its IUPAC name is ethyl (1R,5R,9E)-9-benzylidene-10-oxo-1,7-diphenylspiro[4.5]dec-3-ene-4-carboxylate.
| Compound Name | ethyl (1R,5R,9E)-9-benzylidene-10-oxo-1,7-diphenylspiro[4.5]dec-3-ene-4-carboxylate |
|---|---|
| PubChem CID | 102579351 |
| Molecular Formula | C32H30O3 |
| Molecular Weight | 462.59 g/mol |
| Exact Mass | 462.22 |
| IUPAC Name | ethyl (1R,5R,9E)-9-benzylidene-10-oxo-1,7-diphenylspiro[4.5]dec-3-ene-4-carboxylate |
| SMILES | CCOC(=O)C1=CC[C@H](c2ccccc2)[C@]12CC(c1ccccc1)C/C(=C\c1ccccc1)C2=O |
| InChI | InChI=1S/C32H30O3/c1-2-35-31(34)29-19-18-28(25-16-10-5-11-17-25)32(29)22-27(24-14-8-4-9-15-24)21-26(30(32)33)20-23-12-6-3-7-13-23/h3-17,19-20,27-28H,2,18,21-22H2,1H3/b26-20+/t27?,28-,32-/m1/s1 |
| InChIKey | VYIRAIHSAUOFNI-PJMBGUABSA-N |
| XLogP | 6.88 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.59 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|