C30H31Cl2N5O4 — CID 10257946
tert-butyl N-[(3S)-1-[5-[6-amino-5-[(2,6-dichlorophenyl)methoxy]-3-pyridinyl]-1H-indole-2-carbonyl]pyrrolidin-3-yl]carbamate (PubChem CID 10257946) has the molecular formula C30H31Cl2N5O4 and a molecular weight of 596.52 g/mol. Its IUPAC name is tert-butyl N-[(3S)-1-[5-[6-amino-5-[(2,6-dichlorophenyl)methoxy]-3-pyridinyl]-1H-indole-2-carbonyl]pyrrolidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3S)-1-[5-[6-amino-5-[(2,6-dichlorophenyl)methoxy]-3-pyridinyl]-1H-indole-2-carbonyl]pyrrolidin-3-yl]carbamate |
|---|---|
| PubChem CID | 10257946 |
| Molecular Formula | C30H31Cl2N5O4 |
| Molecular Weight | 596.52 g/mol |
| Exact Mass | 595.18 |
| IUPAC Name | tert-butyl N-[(3S)-1-[5-[6-amino-5-[(2,6-dichlorophenyl)methoxy]-3-pyridinyl]-1H-indole-2-carbonyl]pyrrolidin-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H]1CCN(C(=O)c2cc3cc(-c4cnc(N)c(OCc5c(Cl)cccc5Cl)c4)ccc3[nH]2)C1 |
| InChI | InChI=1S/C30H31Cl2N5O4/c1-30(2,3)41-29(39)35-20-9-10-37(15-20)28(38)25-12-18-11-17(7-8-24(18)36-25)19-13-26(27(33)34-14-19)40-16-21-22(31)5-4-6-23(21)32/h4-8,11-14,20,36H,9-10,15-16H2,1-3H3,(H2,33,34)(H,35,39)/t20-/m0/s1 |
| InChIKey | RMOBLEFAJBJODA-FQEVSTJZSA-N |
| XLogP | 6.44 |
| TPSA | 122.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.52 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_OC_no_alk_C(3)', 'substructure': 'N/A'} |
|---|