C23H37NO7 — CID 102579944
(1S,2R,3R,5S,8R,9R,10R,12R,16S)-11-ethyl-6,17-dimethoxy-12-(methoxymethyl)-11-azahexacyclo[7.6.2.12,5.01,10.03,8.012,16]octadecane-4,7,8,15-tetrol (PubChem CID 102579944) has the molecular formula C23H37NO7 and a molecular weight of 439.55 g/mol. Its IUPAC name is (1S,2R,3R,5S,8R,9R,10R,12R,16S)-11-ethyl-6,17-dimethoxy-12-(methoxymethyl)-11-azahexacyclo[7.6.2.12,5.01,10.03,8.012,16]octadecane-4,7,8,15-tetrol.
| Compound Name | (1S,2R,3R,5S,8R,9R,10R,12R,16S)-11-ethyl-6,17-dimethoxy-12-(methoxymethyl)-11-azahexacyclo[7.6.2.12,5.01,10.03,8.012,16]octadecane-4,7,8,15-tetrol |
|---|---|
| PubChem CID | 102579944 |
| Molecular Formula | C23H37NO7 |
| Molecular Weight | 439.55 g/mol |
| Exact Mass | 439.26 |
| IUPAC Name | (1S,2R,3R,5S,8R,9R,10R,12R,16S)-11-ethyl-6,17-dimethoxy-12-(methoxymethyl)-11-azahexacyclo[7.6.2.12,5.01,10.03,8.012,16]octadecane-4,7,8,15-tetrol |
| SMILES | CCN1[C@@H]2[C@@H]3C(OC)[C@H]4[C@@]2(C(O)CC[C@]41COC)[C@@H]1C[C@@H]2C(OC)C(O)[C@@]3(O)[C@H]1C2O |
| InChI | InChI=1S/C23H37NO7/c1-5-24-19-14-17(31-4)18-21(24,9-29-2)7-6-12(25)22(18,19)11-8-10-15(26)13(11)23(14,28)20(27)16(10)30-3/h10-20,25-28H,5-9H2,1-4H3/t10-,11+,12?,13+,14-,15?,16?,17?,18+,19+,20?,21-,22-,23+/m0/s1 |
| InChIKey | WFWYOJWJILNKLN-XTSYLISXSA-N |
| XLogP | -0.77 |
| TPSA | 111.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.55 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |