C31H27ClN2O5S2 — CID 10258124
N-tert-butyl-2-[4-[[(5Z)-5-[[5-(3-chlorophenyl)furan-2-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]methyl]phenyl]benzenesulfonamide (PubChem CID 10258124) has the molecular formula C31H27ClN2O5S2 and a molecular weight of 607.15 g/mol. Its IUPAC name is N-tert-butyl-2-[4-[[(5Z)-5-[[5-(3-chlorophenyl)furan-2-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]methyl]phenyl]benzenesulfonamide.
| Compound Name | N-tert-butyl-2-[4-[[(5Z)-5-[[5-(3-chlorophenyl)furan-2-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]methyl]phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 10258124 |
| Molecular Formula | C31H27ClN2O5S2 |
| Molecular Weight | 607.15 g/mol |
| Exact Mass | 606.10 |
| IUPAC Name | N-tert-butyl-2-[4-[[(5Z)-5-[[5-(3-chlorophenyl)furan-2-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]methyl]phenyl]benzenesulfonamide |
| SMILES | CC(C)(C)NS(=O)(=O)c1ccccc1-c1ccc(CN2C(=O)S/C(=C\c3ccc(-c4cccc(Cl)c4)o3)C2=O)cc1 |
| InChI | InChI=1S/C31H27ClN2O5S2/c1-31(2,3)33-41(37,38)28-10-5-4-9-25(28)21-13-11-20(12-14-21)19-34-29(35)27(40-30(34)36)18-24-15-16-26(39-24)22-7-6-8-23(32)17-22/h4-18,33H,19H2,1-3H3/b27-18- |
| InChIKey | KZVAJXXILVWAIV-IMRQLAEWSA-N |
| XLogP | 7.58 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.15 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|