C33H48N2O3 — CID 102581255
2-[3,5-bis(4-octoxyphenyl)pyrazol-1-yl]ethanol (PubChem CID 102581255) has the molecular formula C33H48N2O3 and a molecular weight of 520.76 g/mol. Its IUPAC name is 2-[3,5-bis(4-octoxyphenyl)pyrazol-1-yl]ethanol.
| Compound Name | 2-[3,5-bis(4-octoxyphenyl)pyrazol-1-yl]ethanol |
|---|---|
| PubChem CID | 102581255 |
| Molecular Formula | C33H48N2O3 |
| Molecular Weight | 520.76 g/mol |
| Exact Mass | 520.37 |
| IUPAC Name | 2-[3,5-bis(4-octoxyphenyl)pyrazol-1-yl]ethanol |
| SMILES | CCCCCCCCOc1ccc(-c2cc(-c3ccc(OCCCCCCCC)cc3)n(CCO)n2)cc1 |
| InChI | InChI=1S/C33H48N2O3/c1-3-5-7-9-11-13-25-37-30-19-15-28(16-20-30)32-27-33(35(34-32)23-24-36)29-17-21-31(22-18-29)38-26-14-12-10-8-6-4-2/h15-22,27,36H,3-14,23-26H2,1-2H3 |
| InChIKey | LEIGIAVOTLHHTR-UHFFFAOYSA-N |
| XLogP | 8.69 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.76 |
| LogP ≤ 5 | 8.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|