C13H7F3N2OS — CID 102581844
2-[1-oxido-4-(trifluoromethyl)pyridin-1-ium-2-yl]-1,3-benzothiazole (PubChem CID 102581844) has the molecular formula C13H7F3N2OS and a molecular weight of 296.27 g/mol. Its IUPAC name is 2-[1-oxido-4-(trifluoromethyl)pyridin-1-ium-2-yl]-1,3-benzothiazole.
| Compound Name | 2-[1-oxido-4-(trifluoromethyl)pyridin-1-ium-2-yl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 102581844 |
| Molecular Formula | C13H7F3N2OS |
| Molecular Weight | 296.27 g/mol |
| Exact Mass | 296.02 |
| IUPAC Name | 2-[1-oxido-4-(trifluoromethyl)pyridin-1-ium-2-yl]-1,3-benzothiazole |
| SMILES | [O-][n+]1ccc(C(F)(F)F)cc1-c1nc2ccccc2s1 |
| InChI | InChI=1S/C13H7F3N2OS/c14-13(15,16)8-5-6-18(19)10(7-8)12-17-9-3-1-2-4-11(9)20-12/h1-7H |
| InChIKey | KCFNZVQJAQLMQZ-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 39.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.27 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|