C48H50N2O4 — CID 102582760
25,30-dioctyl-25,30-diazadecacyclo[20.5.5.12,6.113,17.01,11.012,22.023,27.028,32.010,34.021,33]tetratriaconta-2,4,6(34),7,9,11,13,15,17(33),18,20-undecaene-24,26,29,31-tetrone (PubChem CID 102582760) has the molecular formula C48H50N2O4 and a molecular weight of 718.94 g/mol. Its IUPAC name is 25,30-dioctyl-25,30-diazadecacyclo[20.5.5.12,6.113,17.01,11.012,22.023,27.028,32.010,34.021,33]tetratriaconta-2,4,6(34),7,9,11,13,15,17(33),18,20-undecaene-24,26,29,31-tetrone.
| Compound Name | 25,30-dioctyl-25,30-diazadecacyclo[20.5.5.12,6.113,17.01,11.012,22.023,27.028,32.010,34.021,33]tetratriaconta-2,4,6(34),7,9,11,13,15,17(33),18,20-undecaene-24,26,29,31-tetrone |
|---|---|
| PubChem CID | 102582760 |
| Molecular Formula | C48H50N2O4 |
| Molecular Weight | 718.94 g/mol |
| Exact Mass | 718.38 |
| IUPAC Name | 25,30-dioctyl-25,30-diazadecacyclo[20.5.5.12,6.113,17.01,11.012,22.023,27.028,32.010,34.021,33]tetratriaconta-2,4,6(34),7,9,11,13,15,17(33),18,20-undecaene-24,26,29,31-tetrone |
| SMILES | CCCCCCCCN1C(=O)C2C(C1=O)C13C(=C4c5cccc6cccc(c56)C42C2C(=O)N(CCCCCCCC)C(=O)C21)c1cccc2cccc3c12 |
| InChI | InChI=1S/C48H50N2O4/c1-3-5-7-9-11-13-27-49-43(51)39-40(44(49)52)48-34-26-18-22-30-20-16-24-32(36(30)34)38(48)37-31-23-15-19-29-21-17-25-33(35(29)31)47(37,39)41-42(48)46(54)50(45(41)53)28-14-12-10-8-6-4-2/h15-26,39-42H,3-14,27-28H2,1-2H3 |
| InChIKey | UCDNVCIRPTTZDI-UHFFFAOYSA-N |
| XLogP | 9.36 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.94 |
| LogP ≤ 5 | 9.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|