C26H31NO8 — CID 102583180
3-(1,4,7,10,13-pentaoxa-16-azacyclooctadecane-16-carbonyl)benzo[h]chromen-2-one (PubChem CID 102583180) has the molecular formula C26H31NO8 and a molecular weight of 485.53 g/mol. Its IUPAC name is 3-(1,4,7,10,13-pentaoxa-16-azacyclooctadecane-16-carbonyl)benzo[h]chromen-2-one.
| Compound Name | 3-(1,4,7,10,13-pentaoxa-16-azacyclooctadecane-16-carbonyl)benzo[h]chromen-2-one |
|---|---|
| PubChem CID | 102583180 |
| Molecular Formula | C26H31NO8 |
| Molecular Weight | 485.53 g/mol |
| Exact Mass | 485.20 |
| IUPAC Name | 3-(1,4,7,10,13-pentaoxa-16-azacyclooctadecane-16-carbonyl)benzo[h]chromen-2-one |
| SMILES | O=C(c1cc2ccc3ccccc3c2oc1=O)N1CCOCCOCCOCCOCCOCC1 |
| InChI | InChI=1S/C26H31NO8/c28-25(23-19-21-6-5-20-3-1-2-4-22(20)24(21)35-26(23)29)27-7-9-30-11-13-32-15-17-34-18-16-33-14-12-31-10-8-27/h1-6,19H,7-18H2 |
| InChIKey | JBAIHHZFJHOENM-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 96.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.53 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|