About 1-[(2-amino-1,3-benzothiazol-6-yl)methyl]-3-hydroxy-2-methylpyridin-4-one
1-[(2-amino-1,3-benzothiazol-6-yl)methyl]-3-hydroxy-2-methylpyridin-4-one (PubChem CID 102584309) has the molecular formula C14H13N3O2S
and a molecular weight of 287.34 g/mol. Its IUPAC name is 1-[(2-amino-1,3-benzothiazol-6-yl)methyl]-3-hydroxy-2-methylpyridin-4-one.
Molecular Properties
| Compound Name | 1-[(2-amino-1,3-benzothiazol-6-yl)methyl]-3-hydroxy-2-methylpyridin-4-one |
| PubChem CID | 102584309 |
| Molecular Formula | C14H13N3O2S |
| Molecular Weight | 287.34 g/mol |
| Exact Mass | 287.07 |
| IUPAC Name | 1-[(2-amino-1,3-benzothiazol-6-yl)methyl]-3-hydroxy-2-methylpyridin-4-one |
| SMILES | Cc1c(O)c(=O)ccn1Cc1ccc2nc(N)sc2c1 |
| InChI | InChI=1S/C14H13N3O2S/c1-8-13(19)11(18)4-5-17(8)7-9-2-3-10-12(6-9)20-14(15)16-10/h2-6,19H,7H2,1H3,(H2,15,16) |
| InChIKey | JVVSVLUDQZOIOA-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.34 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-[(2-amino-1,3-benzothiazol-6-yl)methyl]-3-hydroxy-2-methylpyridin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2-amino-1,3-benzothiazol-6-yl)methyl]-3-hydroxy-2-methylpyridin-4-one?
The IUPAC name of 1-[(2-amino-1,3-benzothiazol-6-yl)methyl]-3-hydroxy-2-methylpyridin-4-one (CID 102584309) is 1-[(2-amino-1,3-benzothiazol-6-yl)methyl]-3-hydroxy-2-methylpyridin-4-one.
What is the SMILES notation for 1-[(2-amino-1,3-benzothiazol-6-yl)methyl]-3-hydroxy-2-methylpyridin-4-one?
The canonical SMILES for 1-[(2-amino-1,3-benzothiazol-6-yl)methyl]-3-hydroxy-2-methylpyridin-4-one is Cc1c(O)c(=O)ccn1Cc1ccc2nc(N)sc2c1.
What is the InChIKey of 1-[(2-amino-1,3-benzothiazol-6-yl)methyl]-3-hydroxy-2-methylpyridin-4-one?
The InChIKey is JVVSVLUDQZOIOA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13N3O2S/c1-8-13(19)11(18)4-5-17(8)7-9-2-3-10-12(6-9)20-14(15)16-10/h2-6,19H,7H2,1H3,(H2,15,16).
What are the key properties of 1-[(2-amino-1,3-benzothiazol-6-yl)methyl]-3-hydroxy-2-methylpyridin-4-one?
1-[(2-amino-1,3-benzothiazol-6-yl)methyl]-3-hydroxy-2-methylpyridin-4-one has a molecular weight of 287.34 g/mol, XLogP of 2.10, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2-amino-1,3-benzothiazol-6-yl)methyl]-3-hydroxy-2-methylpyridin-4-one is sourced from PubChem (CID 102584309), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).