C20H24N4S — CID 126761047
6-[[4-[(1Z,3E)-2-ethylhexa-1,3-dienyl]-5-methylimidazol-1-yl]methyl]-1,3-benzothiazol-2-amine (PubChem CID 126761047) has the molecular formula C20H24N4S and a molecular weight of 352.51 g/mol. Its IUPAC name is 6-[[4-[(1Z,3E)-2-ethylhexa-1,3-dienyl]-5-methylimidazol-1-yl]methyl]-1,3-benzothiazol-2-amine.
| Compound Name | 6-[[4-[(1Z,3E)-2-ethylhexa-1,3-dienyl]-5-methylimidazol-1-yl]methyl]-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 126761047 |
| Molecular Formula | C20H24N4S |
| Molecular Weight | 352.51 g/mol |
| Exact Mass | 352.17 |
| IUPAC Name | 6-[[4-[(1Z,3E)-2-ethylhexa-1,3-dienyl]-5-methylimidazol-1-yl]methyl]-1,3-benzothiazol-2-amine |
| SMILES | CC/C=C/C(=C\c1ncn(Cc2ccc3nc(N)sc3c2)c1C)CC |
| InChI | InChI=1S/C20H24N4S/c1-4-6-7-15(5-2)10-18-14(3)24(13-22-18)12-16-8-9-17-19(11-16)25-20(21)23-17/h6-11,13H,4-5,12H2,1-3H3,(H2,21,23)/b7-6+,15-10- |
| InChIKey | ZXPXHLZNTBKNIN-ZWWGVYCGSA-N |
| XLogP | 5.19 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.51 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|