C26H26N2O4S — CID 102584933
ethyl 5-(2-methylphenyl)-3-(4-methylphenyl)sulfonyl-2-phenyl-4H-imidazole-2-carboxylate (PubChem CID 102584933) has the molecular formula C26H26N2O4S and a molecular weight of 462.57 g/mol. Its IUPAC name is ethyl 5-(2-methylphenyl)-3-(4-methylphenyl)sulfonyl-2-phenyl-4H-imidazole-2-carboxylate.
| Compound Name | ethyl 5-(2-methylphenyl)-3-(4-methylphenyl)sulfonyl-2-phenyl-4H-imidazole-2-carboxylate |
|---|---|
| PubChem CID | 102584933 |
| Molecular Formula | C26H26N2O4S |
| Molecular Weight | 462.57 g/mol |
| Exact Mass | 462.16 |
| IUPAC Name | ethyl 5-(2-methylphenyl)-3-(4-methylphenyl)sulfonyl-2-phenyl-4H-imidazole-2-carboxylate |
| SMILES | CCOC(=O)C1(c2ccccc2)N=C(c2ccccc2C)CN1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C26H26N2O4S/c1-4-32-25(29)26(21-11-6-5-7-12-21)27-24(23-13-9-8-10-20(23)3)18-28(26)33(30,31)22-16-14-19(2)15-17-22/h5-17H,4,18H2,1-3H3 |
| InChIKey | WWIDCVSPRDICNP-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 76.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.57 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |