C9H11IO2 — CID 102586191
(2R,3S)-5-iodo-3-methyl-2-[(E)-prop-1-enyl]-2,3-dihydropyran-4-one (PubChem CID 102586191) has the molecular formula C9H11IO2 and a molecular weight of 278.09 g/mol. Its IUPAC name is (2R,3S)-5-iodo-3-methyl-2-[(E)-prop-1-enyl]-2,3-dihydropyran-4-one.
| Compound Name | (2R,3S)-5-iodo-3-methyl-2-[(E)-prop-1-enyl]-2,3-dihydropyran-4-one |
|---|---|
| PubChem CID | 102586191 |
| Molecular Formula | C9H11IO2 |
| Molecular Weight | 278.09 g/mol |
| Exact Mass | 277.98 |
| IUPAC Name | (2R,3S)-5-iodo-3-methyl-2-[(E)-prop-1-enyl]-2,3-dihydropyran-4-one |
| SMILES | C/C=C/[C@H]1OC=C(I)C(=O)[C@H]1C |
| InChI | InChI=1S/C9H11IO2/c1-3-4-8-6(2)9(11)7(10)5-12-8/h3-6,8H,1-2H3/b4-3+/t6-,8+/m0/s1 |
| InChIKey | UGTCCJNECJUVDO-HVCAEDSRSA-N |
| XLogP | 2.44 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.09 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|