C28H26N2+2 — CID 102586963
1-[(10bS,10cS)-10b,10c-dimethyl-7-pyridin-1-ium-1-yl-4,5-dihydropyren-2-yl]pyridin-1-ium (PubChem CID 102586963) has the molecular formula C28H26N2+2 and a molecular weight of 390.53 g/mol. Its IUPAC name is 1-[(10bS,10cS)-10b,10c-dimethyl-7-pyridin-1-ium-1-yl-4,5-dihydropyren-2-yl]pyridin-1-ium.
| Compound Name | 1-[(10bS,10cS)-10b,10c-dimethyl-7-pyridin-1-ium-1-yl-4,5-dihydropyren-2-yl]pyridin-1-ium |
|---|---|
| PubChem CID | 102586963 |
| Molecular Formula | C28H26N2+2 |
| Molecular Weight | 390.53 g/mol |
| Exact Mass | 390.21 |
| IUPAC Name | 1-[(10bS,10cS)-10b,10c-dimethyl-7-pyridin-1-ium-1-yl-4,5-dihydropyren-2-yl]pyridin-1-ium |
| SMILES | C[C@@]12C3=CC=C4C=C([n+]5ccccc5)C=C(CCC1=CC([n+]1ccccc1)=C3)[C@@]42C |
| InChI | InChI=1S/C28H26N2/c1-27-21-9-11-23-19-26(30-15-7-4-8-16-30)20-24(28(23,27)2)12-10-22(27)18-25(17-21)29-13-5-3-6-14-29/h3-9,11,13-20H,10,12H2,1-2H3/q+2/t27-,28-/m1/s1 |
| InChIKey | UAYQOAZFNWSCHT-VSGBNLITSA-N |
| XLogP | 5.20 |
| TPSA | 7.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.53 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|