C25H28N2O2 — CID 58713683
(4R,4'aS,5R)-1'-benzyl-4,5-bis(ethenyl)-4'a-methylspiro[1,3-dioxolane-2,5'-4,6,7,8-tetrahydrobenzo[f]indazole] (PubChem CID 58713683) has the molecular formula C25H28N2O2 and a molecular weight of 388.51 g/mol. Its IUPAC name is (4R,4'aS,5R)-1'-benzyl-4,5-bis(ethenyl)-4'a-methylspiro[1,3-dioxolane-2,5'-4,6,7,8-tetrahydrobenzo[f]indazole].
| Compound Name | (4R,4'aS,5R)-1'-benzyl-4,5-bis(ethenyl)-4'a-methylspiro[1,3-dioxolane-2,5'-4,6,7,8-tetrahydrobenzo[f]indazole] |
|---|---|
| PubChem CID | 58713683 |
| Molecular Formula | C25H28N2O2 |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.22 |
| IUPAC Name | (4R,4'aS,5R)-1'-benzyl-4,5-bis(ethenyl)-4'a-methylspiro[1,3-dioxolane-2,5'-4,6,7,8-tetrahydrobenzo[f]indazole] |
| SMILES | C=C[C@H]1OC2(CCCC3=Cc4c(cnn4Cc4ccccc4)C[C@@]32C)O[C@@H]1C=C |
| InChI | InChI=1S/C25H28N2O2/c1-4-22-23(5-2)29-25(28-22)13-9-12-20-14-21-19(15-24(20,25)3)16-26-27(21)17-18-10-7-6-8-11-18/h4-8,10-11,14,16,22-23H,1-2,9,12-13,15,17H2,3H3/t22-,23-,24+/m1/s1 |
| InChIKey | FSJJIMIDOBSJGY-SMIHKQSGSA-N |
| XLogP | 4.91 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|