C27H33NO5 — CID 102589617
(4R)-4-benzyl-3-[(E,2R,3R,4R,5S)-3,5-dimethoxy-2,4-dimethyl-7-phenylhept-6-enoyl]-1,3-oxazolidin-2-one (PubChem CID 102589617) has the molecular formula C27H33NO5 and a molecular weight of 451.56 g/mol. Its IUPAC name is (4R)-4-benzyl-3-[(E,2R,3R,4R,5S)-3,5-dimethoxy-2,4-dimethyl-7-phenylhept-6-enoyl]-1,3-oxazolidin-2-one.
| Compound Name | (4R)-4-benzyl-3-[(E,2R,3R,4R,5S)-3,5-dimethoxy-2,4-dimethyl-7-phenylhept-6-enoyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 102589617 |
| Molecular Formula | C27H33NO5 |
| Molecular Weight | 451.56 g/mol |
| Exact Mass | 451.24 |
| IUPAC Name | (4R)-4-benzyl-3-[(E,2R,3R,4R,5S)-3,5-dimethoxy-2,4-dimethyl-7-phenylhept-6-enoyl]-1,3-oxazolidin-2-one |
| SMILES | CO[C@H]([C@H](C)[C@H](/C=C/c1ccccc1)OC)[C@@H](C)C(=O)N1C(=O)OC[C@H]1Cc1ccccc1 |
| InChI | InChI=1S/C27H33NO5/c1-19(24(31-3)16-15-21-11-7-5-8-12-21)25(32-4)20(2)26(29)28-23(18-33-27(28)30)17-22-13-9-6-10-14-22/h5-16,19-20,23-25H,17-18H2,1-4H3/b16-15+/t19-,20-,23-,24+,25-/m1/s1 |
| InChIKey | UBJNMHSPPNMBDG-ICOMIPAJSA-N |
| XLogP | 4.59 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.56 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |