C22H21NO5S — CID 102589658
2-(4-methylphenyl)sulfonyl-1-[(1R,2S,3S,4S)-3-(4-nitrophenyl)-2-bicyclo[2.2.1]hept-5-enyl]ethanone (PubChem CID 102589658) has the molecular formula C22H21NO5S and a molecular weight of 411.48 g/mol. Its IUPAC name is 2-(4-methylphenyl)sulfonyl-1-[(1R,2S,3S,4S)-3-(4-nitrophenyl)-2-bicyclo[2.2.1]hept-5-enyl]ethanone.
| Compound Name | 2-(4-methylphenyl)sulfonyl-1-[(1R,2S,3S,4S)-3-(4-nitrophenyl)-2-bicyclo[2.2.1]hept-5-enyl]ethanone |
|---|---|
| PubChem CID | 102589658 |
| Molecular Formula | C22H21NO5S |
| Molecular Weight | 411.48 g/mol |
| Exact Mass | 411.11 |
| IUPAC Name | 2-(4-methylphenyl)sulfonyl-1-[(1R,2S,3S,4S)-3-(4-nitrophenyl)-2-bicyclo[2.2.1]hept-5-enyl]ethanone |
| SMILES | Cc1ccc(S(=O)(=O)CC(=O)[C@@H]2[C@@H](c3ccc([N+](=O)[O-])cc3)[C@@H]3C=C[C@H]2C3)cc1 |
| InChI | InChI=1S/C22H21NO5S/c1-14-2-10-19(11-3-14)29(27,28)13-20(24)22-17-5-4-16(12-17)21(22)15-6-8-18(9-7-15)23(25)26/h2-11,16-17,21-22H,12-13H2,1H3/t16-,17+,21+,22-/m1/s1 |
| InChIKey | DAIXOWZNIVBAKM-XKPGHWPRSA-N |
| XLogP | 3.85 |
| TPSA | 94.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.48 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|