C15H15NO3S — CID 56955529
S-methyl (1S,2R,3R,4R)-3-(4-nitrophenyl)bicyclo[2.2.1]hept-5-ene-2-carbothioate (PubChem CID 56955529) has the molecular formula C15H15NO3S and a molecular weight of 289.36 g/mol. Its IUPAC name is S-methyl (1S,2R,3R,4R)-3-(4-nitrophenyl)bicyclo[2.2.1]hept-5-ene-2-carbothioate.
| Compound Name | S-methyl (1S,2R,3R,4R)-3-(4-nitrophenyl)bicyclo[2.2.1]hept-5-ene-2-carbothioate |
|---|---|
| PubChem CID | 56955529 |
| Molecular Formula | C15H15NO3S |
| Molecular Weight | 289.36 g/mol |
| Exact Mass | 289.08 |
| IUPAC Name | S-methyl (1S,2R,3R,4R)-3-(4-nitrophenyl)bicyclo[2.2.1]hept-5-ene-2-carbothioate |
| SMILES | CSC(=O)[C@H]1[C@H](c2ccc([N+](=O)[O-])cc2)[C@H]2C=C[C@@H]1C2 |
| InChI | InChI=1S/C15H15NO3S/c1-20-15(17)14-11-3-2-10(8-11)13(14)9-4-6-12(7-5-9)16(18)19/h2-7,10-11,13-14H,8H2,1H3/t10-,11+,13+,14+/m0/s1 |
| InChIKey | DBDYNYYZTYXASA-OIMNJJJWSA-N |
| XLogP | 3.39 |
| TPSA | 60.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.36 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|