C25H30O5 — CID 102590745
dipropan-2-yl (1R,2S,3R,4R)-1-hydroxy-3,4-diphenylcyclopentane-1,2-dicarboxylate (PubChem CID 102590745) has the molecular formula C25H30O5 and a molecular weight of 410.51 g/mol. Its IUPAC name is dipropan-2-yl (1R,2S,3R,4R)-1-hydroxy-3,4-diphenylcyclopentane-1,2-dicarboxylate.
| Compound Name | dipropan-2-yl (1R,2S,3R,4R)-1-hydroxy-3,4-diphenylcyclopentane-1,2-dicarboxylate |
|---|---|
| PubChem CID | 102590745 |
| Molecular Formula | C25H30O5 |
| Molecular Weight | 410.51 g/mol |
| Exact Mass | 410.21 |
| IUPAC Name | dipropan-2-yl (1R,2S,3R,4R)-1-hydroxy-3,4-diphenylcyclopentane-1,2-dicarboxylate |
| SMILES | CC(C)OC(=O)[C@H]1[C@H](c2ccccc2)[C@H](c2ccccc2)C[C@]1(O)C(=O)OC(C)C |
| InChI | InChI=1S/C25H30O5/c1-16(2)29-23(26)22-21(19-13-9-6-10-14-19)20(18-11-7-5-8-12-18)15-25(22,28)24(27)30-17(3)4/h5-14,16-17,20-22,28H,15H2,1-4H3/t20-,21+,22+,25+/m0/s1 |
| InChIKey | POFSPOFPJDIZOC-IYXIZZNPSA-N |
| XLogP | 4.21 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.51 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |