C13H17N3O2 — CID 102591334
(2R)-3-(1H-indol-3-yl)-N,N-dimethyl-2-nitropropan-1-amine (PubChem CID 102591334) has the molecular formula C13H17N3O2 and a molecular weight of 247.30 g/mol. Its IUPAC name is (2R)-3-(1H-indol-3-yl)-N,N-dimethyl-2-nitropropan-1-amine.
| Compound Name | (2R)-3-(1H-indol-3-yl)-N,N-dimethyl-2-nitropropan-1-amine |
|---|---|
| PubChem CID | 102591334 |
| Molecular Formula | C13H17N3O2 |
| Molecular Weight | 247.30 g/mol |
| Exact Mass | 247.13 |
| IUPAC Name | (2R)-3-(1H-indol-3-yl)-N,N-dimethyl-2-nitropropan-1-amine |
| SMILES | CN(C)C[C@@H](Cc1c[nH]c2ccccc12)[N+](=O)[O-] |
| InChI | InChI=1S/C13H17N3O2/c1-15(2)9-11(16(17)18)7-10-8-14-13-6-4-3-5-12(10)13/h3-6,8,11,14H,7,9H2,1-2H3/t11-/m1/s1 |
| InChIKey | VNYNFGNFSWSSIN-LLVKDONJSA-N |
| XLogP | 1.92 |
| TPSA | 62.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.30 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|