C17H14N2O2 — CID 102591338
2-[(2S)-2-(4-methylphenyl)aziridin-1-yl]isoindole-1,3-dione (PubChem CID 102591338) has the molecular formula C17H14N2O2 and a molecular weight of 278.31 g/mol. Its IUPAC name is 2-[(2S)-2-(4-methylphenyl)aziridin-1-yl]isoindole-1,3-dione.
| Compound Name | 2-[(2S)-2-(4-methylphenyl)aziridin-1-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 102591338 |
| Molecular Formula | C17H14N2O2 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.11 |
| IUPAC Name | 2-[(2S)-2-(4-methylphenyl)aziridin-1-yl]isoindole-1,3-dione |
| SMILES | Cc1ccc([C@H]2CN2N2C(=O)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C17H14N2O2/c1-11-6-8-12(9-7-11)15-10-18(15)19-16(20)13-4-2-3-5-14(13)17(19)21/h2-9,15H,10H2,1H3/t15-,18?/m1/s1 |
| InChIKey | NUWRRHJYLKXBST-NNJIEVJOSA-N |
| XLogP | 2.56 |
| TPSA | 40.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|