C15H23N3O7 — CID 102591989
3-[4-[[(2S,3S,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]methyl]triazol-1-yl]propyl prop-2-enoate (PubChem CID 102591989) has the molecular formula C15H23N3O7 and a molecular weight of 357.36 g/mol. Its IUPAC name is 3-[4-[[(2S,3S,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]methyl]triazol-1-yl]propyl prop-2-enoate.
| Compound Name | 3-[4-[[(2S,3S,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]methyl]triazol-1-yl]propyl prop-2-enoate |
|---|---|
| PubChem CID | 102591989 |
| Molecular Formula | C15H23N3O7 |
| Molecular Weight | 357.36 g/mol |
| Exact Mass | 357.15 |
| IUPAC Name | 3-[4-[[(2S,3S,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]methyl]triazol-1-yl]propyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCn1cc(C[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]2O)nn1 |
| InChI | InChI=1S/C15H23N3O7/c1-2-12(20)24-5-3-4-18-7-9(16-17-18)6-10-13(21)15(23)14(22)11(8-19)25-10/h2,7,10-11,13-15,19,21-23H,1,3-6,8H2/t10-,11+,13+,14+,15+/m0/s1 |
| InChIKey | QSDQQUFWVJDYCJ-PWRGDLIESA-N |
| XLogP | -2.22 |
| TPSA | 147.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.36 |
| LogP ≤ 5 | -2.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|