About [(1S,2S)-2-amino-1-methoxycarbonylcyclohex-3-en-1-yl]phosphonic acid
[(1S,2S)-2-amino-1-methoxycarbonylcyclohex-3-en-1-yl]phosphonic acid (PubChem CID 102594160) has the molecular formula C8H14NO5P
and a molecular weight of 235.18 g/mol. Its IUPAC name is [(1S,2S)-2-amino-1-methoxycarbonylcyclohex-3-en-1-yl]phosphonic acid.
Molecular Properties
| Compound Name | [(1S,2S)-2-amino-1-methoxycarbonylcyclohex-3-en-1-yl]phosphonic acid |
| PubChem CID | 102594160 |
| Molecular Formula | C8H14NO5P |
| Molecular Weight | 235.18 g/mol |
| Exact Mass | 235.06 |
| IUPAC Name | [(1S,2S)-2-amino-1-methoxycarbonylcyclohex-3-en-1-yl]phosphonic acid |
| SMILES | COC(=O)[C@]1(P(=O)(O)O)CCC=C[C@@H]1N |
| InChI | InChI=1S/C8H14NO5P/c1-14-7(10)8(15(11,12)13)5-3-2-4-6(8)9/h2,4,6H,3,5,9H2,1H3,(H2,11,12,13)/t6-,8-/m0/s1 |
| InChIKey | MINVMPCRMVWVAM-XPUUQOCRSA-N |
| XLogP | -0.25 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.18 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [(1S,2S)-2-amino-1-methoxycarbonylcyclohex-3-en-1-yl]phosphonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S,2S)-2-amino-1-methoxycarbonylcyclohex-3-en-1-yl]phosphonic acid?
The IUPAC name of [(1S,2S)-2-amino-1-methoxycarbonylcyclohex-3-en-1-yl]phosphonic acid (CID 102594160) is [(1S,2S)-2-amino-1-methoxycarbonylcyclohex-3-en-1-yl]phosphonic acid.
What is the SMILES notation for [(1S,2S)-2-amino-1-methoxycarbonylcyclohex-3-en-1-yl]phosphonic acid?
The canonical SMILES for [(1S,2S)-2-amino-1-methoxycarbonylcyclohex-3-en-1-yl]phosphonic acid is COC(=O)[C@]1(P(=O)(O)O)CCC=C[C@@H]1N.
What is the InChIKey of [(1S,2S)-2-amino-1-methoxycarbonylcyclohex-3-en-1-yl]phosphonic acid?
The InChIKey is MINVMPCRMVWVAM-XPUUQOCRSA-N. The full InChI is InChI=1S/C8H14NO5P/c1-14-7(10)8(15(11,12)13)5-3-2-4-6(8)9/h2,4,6H,3,5,9H2,1H3,(H2,11,12,13)/t6-,8-/m0/s1.
What are the key properties of [(1S,2S)-2-amino-1-methoxycarbonylcyclohex-3-en-1-yl]phosphonic acid?
[(1S,2S)-2-amino-1-methoxycarbonylcyclohex-3-en-1-yl]phosphonic acid has a molecular weight of 235.18 g/mol, XLogP of -0.25, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S,2S)-2-amino-1-methoxycarbonylcyclohex-3-en-1-yl]phosphonic acid is sourced from PubChem (CID 102594160), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).