C8H14NO5P — CID 102594160
[(1S,2S)-2-amino-1-methoxycarbonylcyclohex-3-en-1-yl]phosphonic acid (PubChem CID 102594160) has the molecular formula C8H14NO5P and a molecular weight of 235.18 g/mol. Its IUPAC name is [(1S,2S)-2-amino-1-methoxycarbonylcyclohex-3-en-1-yl]phosphonic acid.
| Compound Name | [(1S,2S)-2-amino-1-methoxycarbonylcyclohex-3-en-1-yl]phosphonic acid |
|---|---|
| PubChem CID | 102594160 |
| Molecular Formula | C8H14NO5P |
| Molecular Weight | 235.18 g/mol |
| Exact Mass | 235.06 |
| IUPAC Name | [(1S,2S)-2-amino-1-methoxycarbonylcyclohex-3-en-1-yl]phosphonic acid |
| SMILES | COC(=O)[C@]1(P(=O)(O)O)CCC=C[C@@H]1N |
| InChI | InChI=1S/C8H14NO5P/c1-14-7(10)8(15(11,12)13)5-3-2-4-6(8)9/h2,4,6H,3,5,9H2,1H3,(H2,11,12,13)/t6-,8-/m0/s1 |
| InChIKey | MINVMPCRMVWVAM-XPUUQOCRSA-N |
| XLogP | -0.25 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.18 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|