C10H12O2 — CID 102594203
(3aR)-1-hydroxy-3-methylidene-4,5,6,7-tetrahydro-3aH-inden-2-one (PubChem CID 102594203) has the molecular formula C10H12O2 and a molecular weight of 164.20 g/mol. Its IUPAC name is (3aR)-1-hydroxy-3-methylidene-4,5,6,7-tetrahydro-3aH-inden-2-one.
| Compound Name | (3aR)-1-hydroxy-3-methylidene-4,5,6,7-tetrahydro-3aH-inden-2-one |
|---|---|
| PubChem CID | 102594203 |
| Molecular Formula | C10H12O2 |
| Molecular Weight | 164.20 g/mol |
| Exact Mass | 164.08 |
| IUPAC Name | (3aR)-1-hydroxy-3-methylidene-4,5,6,7-tetrahydro-3aH-inden-2-one |
| SMILES | C=C1C(=O)C(O)=C2CCCC[C@@H]12 |
| InChI | InChI=1S/C10H12O2/c1-6-7-4-2-3-5-8(7)10(12)9(6)11/h7,12H,1-5H2/t7-/m0/s1 |
| InChIKey | UJWOGEDYTWCNDB-ZETCQYMHSA-N |
| XLogP | 2.13 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.20 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|