C29H27NO4 — CID 102598089
(1R,6R,13S)-4,17,17-trimethyl-20-(4-methylphenyl)-5-oxa-20-azapentacyclo[11.8.0.01,6.07,12.014,19]henicosa-3,7,9,11,14(19)-pentaene-2,15,21-trione (PubChem CID 102598089) has the molecular formula C29H27NO4 and a molecular weight of 453.54 g/mol. Its IUPAC name is (1R,6R,13S)-4,17,17-trimethyl-20-(4-methylphenyl)-5-oxa-20-azapentacyclo[11.8.0.01,6.07,12.014,19]henicosa-3,7,9,11,14(19)-pentaene-2,15,21-trione.
| Compound Name | (1R,6R,13S)-4,17,17-trimethyl-20-(4-methylphenyl)-5-oxa-20-azapentacyclo[11.8.0.01,6.07,12.014,19]henicosa-3,7,9,11,14(19)-pentaene-2,15,21-trione |
|---|---|
| PubChem CID | 102598089 |
| Molecular Formula | C29H27NO4 |
| Molecular Weight | 453.54 g/mol |
| Exact Mass | 453.19 |
| IUPAC Name | (1R,6R,13S)-4,17,17-trimethyl-20-(4-methylphenyl)-5-oxa-20-azapentacyclo[11.8.0.01,6.07,12.014,19]henicosa-3,7,9,11,14(19)-pentaene-2,15,21-trione |
| SMILES | CC1=CC(=O)[C@@]23C(=O)N(c4ccc(C)cc4)C4=C(C(=O)CC(C)(C)C4)[C@@H]2c2ccccc2[C@H]3O1 |
| InChI | InChI=1S/C29H27NO4/c1-16-9-11-18(12-10-16)30-21-14-28(3,4)15-22(31)24(21)25-19-7-5-6-8-20(19)26-29(25,27(30)33)23(32)13-17(2)34-26/h5-13,25-26H,14-15H2,1-4H3/t25-,26+,29+/m0/s1 |
| InChIKey | HNGIRJYSYIMLSK-IWVFXYMLSA-N |
| XLogP | 5.31 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.54 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|