C15H14BrNO3 — CID 102599803
methyl 1-benzyl-3-bromo-7-oxo-4H-azepine-6-carboxylate (PubChem CID 102599803) has the molecular formula C15H14BrNO3 and a molecular weight of 336.19 g/mol. Its IUPAC name is methyl 1-benzyl-3-bromo-7-oxo-4H-azepine-6-carboxylate.
| Compound Name | methyl 1-benzyl-3-bromo-7-oxo-4H-azepine-6-carboxylate |
|---|---|
| PubChem CID | 102599803 |
| Molecular Formula | C15H14BrNO3 |
| Molecular Weight | 336.19 g/mol |
| Exact Mass | 335.02 |
| IUPAC Name | methyl 1-benzyl-3-bromo-7-oxo-4H-azepine-6-carboxylate |
| SMILES | COC(=O)C1=CCC(Br)=CN(Cc2ccccc2)C1=O |
| InChI | InChI=1S/C15H14BrNO3/c1-20-15(19)13-8-7-12(16)10-17(14(13)18)9-11-5-3-2-4-6-11/h2-6,8,10H,7,9H2,1H3 |
| InChIKey | WDPLNZXZWFLRCE-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.19 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|