C25H41NO7S — CID 102601797
18-(N-methylanilino)-18-oxo-9-sulfooxyoctadecanoic acid (PubChem CID 102601797) has the molecular formula C25H41NO7S and a molecular weight of 499.67 g/mol. Its IUPAC name is 18-(N-methylanilino)-18-oxo-9-sulfooxyoctadecanoic acid.
| Compound Name | 18-(N-methylanilino)-18-oxo-9-sulfooxyoctadecanoic acid |
|---|---|
| PubChem CID | 102601797 |
| Molecular Formula | C25H41NO7S |
| Molecular Weight | 499.67 g/mol |
| Exact Mass | 499.26 |
| IUPAC Name | 18-(N-methylanilino)-18-oxo-9-sulfooxyoctadecanoic acid |
| SMILES | CN(C(=O)CCCCCCCCC(CCCCCCCC(=O)O)OS(=O)(=O)O)c1ccccc1 |
| InChI | InChI=1S/C25H41NO7S/c1-26(22-16-10-9-11-17-22)24(27)20-14-7-3-2-5-12-18-23(33-34(30,31)32)19-13-6-4-8-15-21-25(28)29/h9-11,16-17,23H,2-8,12-15,18-21H2,1H3,(H,28,29)(H,30,31,32) |
| InChIKey | NBZOLVDUJOVTHL-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 121.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.67 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|