About 4-amino-N-methyl-N-phenyltetradecanamide
4-amino-N-methyl-N-phenyltetradecanamide (PubChem CID 154348615) has the molecular formula C21H36N2O
and a molecular weight of 332.53 g/mol. Its IUPAC name is 4-amino-N-methyl-N-phenyltetradecanamide.
Molecular Properties
| Compound Name | 4-amino-N-methyl-N-phenyltetradecanamide |
| PubChem CID | 154348615 |
| Molecular Formula | C21H36N2O |
| Molecular Weight | 332.53 g/mol |
| Exact Mass | 332.28 |
| IUPAC Name | 4-amino-N-methyl-N-phenyltetradecanamide |
| SMILES | CCCCCCCCCCC(N)CCC(=O)N(C)c1ccccc1 |
| InChI | InChI=1S/C21H36N2O/c1-3-4-5-6-7-8-9-11-14-19(22)17-18-21(24)23(2)20-15-12-10-13-16-20/h10,12-13,15-16,19H,3-9,11,14,17-18,22H2,1-2H3 |
| InChIKey | BNSZRRKCDQCYBZ-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 332.53 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-amino-N-methyl-N-phenyltetradecanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-N-methyl-N-phenyltetradecanamide?
The IUPAC name of 4-amino-N-methyl-N-phenyltetradecanamide (CID 154348615) is 4-amino-N-methyl-N-phenyltetradecanamide.
What is the SMILES notation for 4-amino-N-methyl-N-phenyltetradecanamide?
The canonical SMILES for 4-amino-N-methyl-N-phenyltetradecanamide is CCCCCCCCCCC(N)CCC(=O)N(C)c1ccccc1.
What is the InChIKey of 4-amino-N-methyl-N-phenyltetradecanamide?
The InChIKey is BNSZRRKCDQCYBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H36N2O/c1-3-4-5-6-7-8-9-11-14-19(22)17-18-21(24)23(2)20-15-12-10-13-16-20/h10,12-13,15-16,19H,3-9,11,14,17-18,22H2,1-2H3.
What are the key properties of 4-amino-N-methyl-N-phenyltetradecanamide?
4-amino-N-methyl-N-phenyltetradecanamide has a molecular weight of 332.53 g/mol, XLogP of 5.29, 13 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-N-methyl-N-phenyltetradecanamide is sourced from PubChem (CID 154348615), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).