C38H50Br2N2O10S2 — CID 10260204
bis[2-[4-methyl-3-[(2,3,4-trimethoxyphenyl)methyl]-1,3-thiazol-3-ium-5-yl]ethyl] hexanedioate dibromide (PubChem CID 10260204) has the molecular formula C38H50Br2N2O10S2 and a molecular weight of 918.76 g/mol. Its IUPAC name is bis[2-[4-methyl-3-[(2,3,4-trimethoxyphenyl)methyl]-1,3-thiazol-3-ium-5-yl]ethyl] hexanedioate dibromide.
| Compound Name | bis[2-[4-methyl-3-[(2,3,4-trimethoxyphenyl)methyl]-1,3-thiazol-3-ium-5-yl]ethyl] hexanedioate dibromide |
|---|---|
| PubChem CID | 10260204 |
| Molecular Formula | C38H50Br2N2O10S2 |
| Molecular Weight | 918.76 g/mol |
| Exact Mass | 916.13 |
| IUPAC Name | bis[2-[4-methyl-3-[(2,3,4-trimethoxyphenyl)methyl]-1,3-thiazol-3-ium-5-yl]ethyl] hexanedioate dibromide |
| SMILES | COc1ccc(C[n+]2csc(CCOC(=O)CCCCC(=O)OCCc3sc[n+](Cc4ccc(OC)c(OC)c4OC)c3C)c2C)c(OC)c1OC.[Br-].[Br-] |
| InChI | InChI=1S/C38H50N2O10S2.2BrH/c1-25-31(51-23-39(25)21-27-13-15-29(43-3)37(47-7)35(27)45-5)17-19-49-33(41)11-9-10-12-34(42)50-20-18-32-26(2)40(24-52-32)22-28-14-16-30(44-4)38(48-8)36(28)46-6;;/h13-16,23-24H,9-12,17-22H2,1-8H3;2*1H/q+2;;/p-2 |
| InChIKey | RKRJYZNZCLSMLF-UHFFFAOYSA-L |
| XLogP | -0.41 |
| TPSA | 115.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 918.76 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|