C20H30N2O4S2+2 — CID 10032494
bis[2-(3-ethyl-4-methyl-1,3-thiazol-3-ium-5-yl)ethyl] butanedioate (PubChem CID 10032494) has the molecular formula C20H30N2O4S2+2 and a molecular weight of 426.60 g/mol. Its IUPAC name is bis[2-(3-ethyl-4-methyl-1,3-thiazol-3-ium-5-yl)ethyl] butanedioate.
| Compound Name | bis[2-(3-ethyl-4-methyl-1,3-thiazol-3-ium-5-yl)ethyl] butanedioate |
|---|---|
| PubChem CID | 10032494 |
| Molecular Formula | C20H30N2O4S2+2 |
| Molecular Weight | 426.60 g/mol |
| Exact Mass | 426.16 |
| IUPAC Name | bis[2-(3-ethyl-4-methyl-1,3-thiazol-3-ium-5-yl)ethyl] butanedioate |
| SMILES | CC[n+]1csc(CCOC(=O)CCC(=O)OCCc2sc[n+](CC)c2C)c1C |
| InChI | InChI=1S/C20H30N2O4S2/c1-5-21-13-27-17(15(21)3)9-11-25-19(23)7-8-20(24)26-12-10-18-16(4)22(6-2)14-28-18/h13-14H,5-12H2,1-4H3/q+2 |
| InChIKey | YPFSPKXISKTKPY-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 60.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.60 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|