C42H58Br2N2O4S2 — CID 10328296
bis[2-[4-methyl-3-[(2,3,4,5,6-pentamethylphenyl)methyl]-1,3-thiazol-3-ium-5-yl]ethyl] hexanedioate dibromide (PubChem CID 10328296) has the molecular formula C42H58Br2N2O4S2 and a molecular weight of 878.88 g/mol. Its IUPAC name is bis[2-[4-methyl-3-[(2,3,4,5,6-pentamethylphenyl)methyl]-1,3-thiazol-3-ium-5-yl]ethyl] hexanedioate dibromide.
| Compound Name | bis[2-[4-methyl-3-[(2,3,4,5,6-pentamethylphenyl)methyl]-1,3-thiazol-3-ium-5-yl]ethyl] hexanedioate dibromide |
|---|---|
| PubChem CID | 10328296 |
| Molecular Formula | C42H58Br2N2O4S2 |
| Molecular Weight | 878.88 g/mol |
| Exact Mass | 876.22 |
| IUPAC Name | bis[2-[4-methyl-3-[(2,3,4,5,6-pentamethylphenyl)methyl]-1,3-thiazol-3-ium-5-yl]ethyl] hexanedioate dibromide |
| SMILES | Cc1c(C)c(C)c(C[n+]2csc(CCOC(=O)CCCCC(=O)OCCc3sc[n+](Cc4c(C)c(C)c(C)c(C)c4C)c3C)c2C)c(C)c1C.[Br-].[Br-] |
| InChI | InChI=1S/C42H58N2O4S2.2BrH/c1-25-27(3)31(7)37(32(8)28(25)4)21-43-23-49-39(35(43)11)17-19-47-41(45)15-13-14-16-42(46)48-20-18-40-36(12)44(24-50-40)22-38-33(9)29(5)26(2)30(6)34(38)10;;/h23-24H,13-22H2,1-12H3;2*1H/q+2;;/p-2 |
| InChIKey | XWSSEAMNSRDNEG-UHFFFAOYSA-L |
| XLogP | 2.62 |
| TPSA | 60.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 52 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 878.88 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|