C21H26NO2S+ — CID 7330124
2-(3-benzyl-4-methyl-1,3-thiazol-3-ium-5-yl)ethyl (1S,2S,4S)-bicyclo[2.2.1]heptane-2-carboxylate (PubChem CID 7330124) has the molecular formula C21H26NO2S+ and a molecular weight of 356.51 g/mol. Its IUPAC name is 2-(3-benzyl-4-methyl-1,3-thiazol-3-ium-5-yl)ethyl (1S,2S,4S)-bicyclo[2.2.1]heptane-2-carboxylate.
| Compound Name | 2-(3-benzyl-4-methyl-1,3-thiazol-3-ium-5-yl)ethyl (1S,2S,4S)-bicyclo[2.2.1]heptane-2-carboxylate |
|---|---|
| PubChem CID | 7330124 |
| Molecular Formula | C21H26NO2S+ |
| Molecular Weight | 356.51 g/mol |
| Exact Mass | 356.17 |
| IUPAC Name | 2-(3-benzyl-4-methyl-1,3-thiazol-3-ium-5-yl)ethyl (1S,2S,4S)-bicyclo[2.2.1]heptane-2-carboxylate |
| SMILES | Cc1c(CCOC(=O)[C@H]2C[C@H]3CC[C@H]2C3)sc[n+]1Cc1ccccc1 |
| InChI | InChI=1S/C21H26NO2S/c1-15-20(25-14-22(15)13-16-5-3-2-4-6-16)9-10-24-21(23)19-12-17-7-8-18(19)11-17/h2-6,14,17-19H,7-13H2,1H3/q+1/t17-,18-,19-/m0/s1 |
| InChIKey | NCCVDLWEVVEGSE-FHWLQOOXSA-N |
| XLogP | 3.91 |
| TPSA | 30.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.51 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|