C20H27N2O2S+ — CID 3137536
2-[3-(cyanomethyl)-4-methyl-1,3-thiazol-3-ium-5-yl]ethyl 3-methyladamantane-1-carboxylate (PubChem CID 3137536) has the molecular formula C20H27N2O2S+ and a molecular weight of 359.52 g/mol. Its IUPAC name is 2-[3-(cyanomethyl)-4-methyl-1,3-thiazol-3-ium-5-yl]ethyl 3-methyladamantane-1-carboxylate.
| Compound Name | 2-[3-(cyanomethyl)-4-methyl-1,3-thiazol-3-ium-5-yl]ethyl 3-methyladamantane-1-carboxylate |
|---|---|
| PubChem CID | 3137536 |
| Molecular Formula | C20H27N2O2S+ |
| Molecular Weight | 359.52 g/mol |
| Exact Mass | 359.18 |
| IUPAC Name | 2-[3-(cyanomethyl)-4-methyl-1,3-thiazol-3-ium-5-yl]ethyl 3-methyladamantane-1-carboxylate |
| SMILES | Cc1c(CCOC(=O)C23CC4CC(CC(C)(C4)C2)C3)sc[n+]1CC#N |
| InChI | InChI=1S/C20H27N2O2S/c1-14-17(25-13-22(14)5-4-21)3-6-24-18(23)20-10-15-7-16(11-20)9-19(2,8-15)12-20/h13,15-16H,3,5-12H2,1-2H3/q+1 |
| InChIKey | WYESXHHXQSLESP-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 53.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.52 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|