C9H8ClN5O2 — CID 102606223
2-chloro-4-(oxetan-3-yloxy)-6-pyrazol-1-yl-1,3,5-triazine (PubChem CID 102606223) has the molecular formula C9H8ClN5O2 and a molecular weight of 253.65 g/mol. Its IUPAC name is 2-chloro-4-(oxetan-3-yloxy)-6-pyrazol-1-yl-1,3,5-triazine.
| Compound Name | 2-chloro-4-(oxetan-3-yloxy)-6-pyrazol-1-yl-1,3,5-triazine |
|---|---|
| PubChem CID | 102606223 |
| Molecular Formula | C9H8ClN5O2 |
| Molecular Weight | 253.65 g/mol |
| Exact Mass | 253.04 |
| IUPAC Name | 2-chloro-4-(oxetan-3-yloxy)-6-pyrazol-1-yl-1,3,5-triazine |
| SMILES | Clc1nc(OC2COC2)nc(-n2cccn2)n1 |
| InChI | InChI=1S/C9H8ClN5O2/c10-7-12-8(15-3-1-2-11-15)14-9(13-7)17-6-4-16-5-6/h1-3,6H,4-5H2 |
| InChIKey | BWPHSLURVPRRLG-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 74.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.65 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |