C11H14O3 — CID 10262037
8-methoxy-3-methyl-3,4-dihydro-1H-isochromen-6-ol (PubChem CID 10262037) has the molecular formula C11H14O3 and a molecular weight of 194.23 g/mol. Its IUPAC name is 8-methoxy-3-methyl-3,4-dihydro-1H-isochromen-6-ol.
| Compound Name | 8-methoxy-3-methyl-3,4-dihydro-1H-isochromen-6-ol |
|---|---|
| PubChem CID | 10262037 |
| Molecular Formula | C11H14O3 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.09 |
| IUPAC Name | 8-methoxy-3-methyl-3,4-dihydro-1H-isochromen-6-ol |
| SMILES | COc1cc(O)cc2c1COC(C)C2 |
| InChI | InChI=1S/C11H14O3/c1-7-3-8-4-9(12)5-11(13-2)10(8)6-14-7/h4-5,7,12H,3,6H2,1-2H3 |
| InChIKey | PQSAZKPYHXPOFX-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |