C21H34O3 — CID 10735472
8-methoxy-3,7-dimethyl-6-nonoxy-3,4-dihydro-1H-isochromene (PubChem CID 10735472) has the molecular formula C21H34O3 and a molecular weight of 334.50 g/mol. Its IUPAC name is 8-methoxy-3,7-dimethyl-6-nonoxy-3,4-dihydro-1H-isochromene.
| Compound Name | 8-methoxy-3,7-dimethyl-6-nonoxy-3,4-dihydro-1H-isochromene |
|---|---|
| PubChem CID | 10735472 |
| Molecular Formula | C21H34O3 |
| Molecular Weight | 334.50 g/mol |
| Exact Mass | 334.25 |
| IUPAC Name | 8-methoxy-3,7-dimethyl-6-nonoxy-3,4-dihydro-1H-isochromene |
| SMILES | CCCCCCCCCOc1cc2c(c(OC)c1C)COC(C)C2 |
| InChI | InChI=1S/C21H34O3/c1-5-6-7-8-9-10-11-12-23-20-14-18-13-16(2)24-15-19(18)21(22-4)17(20)3/h14,16H,5-13,15H2,1-4H3 |
| InChIKey | UPEUYMRKVKVRGA-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.50 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|