C11H16O3S — CID 102620749
1-(2,5-dimethylphenyl)ethyl methanesulfonate (PubChem CID 102620749) has the molecular formula C11H16O3S and a molecular weight of 228.31 g/mol. Its IUPAC name is 1-(2,5-dimethylphenyl)ethyl methanesulfonate.
| Compound Name | 1-(2,5-dimethylphenyl)ethyl methanesulfonate |
|---|---|
| PubChem CID | 102620749 |
| Molecular Formula | C11H16O3S |
| Molecular Weight | 228.31 g/mol |
| Exact Mass | 228.08 |
| IUPAC Name | 1-(2,5-dimethylphenyl)ethyl methanesulfonate |
| SMILES | Cc1ccc(C)c(C(C)OS(C)(=O)=O)c1 |
| InChI | InChI=1S/C11H16O3S/c1-8-5-6-9(2)11(7-8)10(3)14-15(4,12)13/h5-7,10H,1-4H3 |
| InChIKey | AACZMBKXRRRJIW-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.31 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|