C17H20N4 — CID 102626248
N-[(4-aminophenyl)methyl]-N-propylimidazo[1,2-a]pyridin-5-amine (PubChem CID 102626248) has the molecular formula C17H20N4 and a molecular weight of 280.38 g/mol. Its IUPAC name is N-[(4-aminophenyl)methyl]-N-propylimidazo[1,2-a]pyridin-5-amine.
| Compound Name | N-[(4-aminophenyl)methyl]-N-propylimidazo[1,2-a]pyridin-5-amine |
|---|---|
| PubChem CID | 102626248 |
| Molecular Formula | C17H20N4 |
| Molecular Weight | 280.38 g/mol |
| Exact Mass | 280.17 |
| IUPAC Name | N-[(4-aminophenyl)methyl]-N-propylimidazo[1,2-a]pyridin-5-amine |
| SMILES | CCCN(Cc1ccc(N)cc1)c1cccc2nccn12 |
| InChI | InChI=1S/C17H20N4/c1-2-11-20(13-14-6-8-15(18)9-7-14)17-5-3-4-16-19-10-12-21(16)17/h3-10,12H,2,11,13,18H2,1H3 |
| InChIKey | BEBHKBIBALZLQI-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 46.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.38 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|