C13H27NO — CID 10262643
(E,2R)-1-aminotridec-5-en-2-ol (PubChem CID 10262643) has the molecular formula C13H27NO and a molecular weight of 213.36 g/mol. Its IUPAC name is (E,2R)-1-aminotridec-5-en-2-ol.
| Compound Name | (E,2R)-1-aminotridec-5-en-2-ol |
|---|---|
| PubChem CID | 10262643 |
| Molecular Formula | C13H27NO |
| Molecular Weight | 213.36 g/mol |
| Exact Mass | 213.21 |
| IUPAC Name | (E,2R)-1-aminotridec-5-en-2-ol |
| SMILES | CCCCCCC/C=C/CC[C@@H](O)CN |
| InChI | InChI=1S/C13H27NO/c1-2-3-4-5-6-7-8-9-10-11-13(15)12-14/h8-9,13,15H,2-7,10-12,14H2,1H3/b9-8+/t13-/m1/s1 |
| InChIKey | DWDAHMXGVSCAHG-MMQHEFTJSA-N |
| XLogP | 3.00 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.36 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|