About (4-nitrophenyl)-(1,3-thiazol-2-yl)methanone
(4-nitrophenyl)-(1,3-thiazol-2-yl)methanone (PubChem CID 10263418) has the molecular formula C10H6N2O3S
and a molecular weight of 234.24 g/mol. Its IUPAC name is (4-nitrophenyl)-(1,3-thiazol-2-yl)methanone.
Molecular Properties
| Compound Name | (4-nitrophenyl)-(1,3-thiazol-2-yl)methanone |
| PubChem CID | 10263418 |
| Molecular Formula | C10H6N2O3S |
| Molecular Weight | 234.24 g/mol |
| Exact Mass | 234.01 |
| IUPAC Name | (4-nitrophenyl)-(1,3-thiazol-2-yl)methanone |
| SMILES | O=C(c1ccc([N+](=O)[O-])cc1)c1nccs1 |
| InChI | InChI=1S/C10H6N2O3S/c13-9(10-11-5-6-16-10)7-1-3-8(4-2-7)12(14)15/h1-6H |
| InChIKey | JJYCVBMNMBNAJI-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 73.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.24 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (4-nitrophenyl)-(1,3-thiazol-2-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-nitrophenyl)-(1,3-thiazol-2-yl)methanone?
The IUPAC name of (4-nitrophenyl)-(1,3-thiazol-2-yl)methanone (CID 10263418) is (4-nitrophenyl)-(1,3-thiazol-2-yl)methanone.
What is the SMILES notation for (4-nitrophenyl)-(1,3-thiazol-2-yl)methanone?
The canonical SMILES for (4-nitrophenyl)-(1,3-thiazol-2-yl)methanone is O=C(c1ccc([N+](=O)[O-])cc1)c1nccs1.
What is the InChIKey of (4-nitrophenyl)-(1,3-thiazol-2-yl)methanone?
The InChIKey is JJYCVBMNMBNAJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H6N2O3S/c13-9(10-11-5-6-16-10)7-1-3-8(4-2-7)12(14)15/h1-6H.
What are the key properties of (4-nitrophenyl)-(1,3-thiazol-2-yl)methanone?
(4-nitrophenyl)-(1,3-thiazol-2-yl)methanone has a molecular weight of 234.24 g/mol, XLogP of 2.28, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4-nitrophenyl)-(1,3-thiazol-2-yl)methanone is sourced from PubChem (CID 10263418), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).