C9H15BrO2 — CID 10263456
(5E)-2-bromo-4-(methoxymethoxy)hepta-1,5-diene (PubChem CID 10263456) has the molecular formula C9H15BrO2 and a molecular weight of 235.12 g/mol. Its IUPAC name is (5E)-2-bromo-4-(methoxymethoxy)hepta-1,5-diene.
| Compound Name | (5E)-2-bromo-4-(methoxymethoxy)hepta-1,5-diene |
|---|---|
| PubChem CID | 10263456 |
| Molecular Formula | C9H15BrO2 |
| Molecular Weight | 235.12 g/mol |
| Exact Mass | 234.03 |
| IUPAC Name | (5E)-2-bromo-4-(methoxymethoxy)hepta-1,5-diene |
| SMILES | C=C(Br)CC(/C=C/C)OCOC |
| InChI | InChI=1S/C9H15BrO2/c1-4-5-9(6-8(2)10)12-7-11-3/h4-5,9H,2,6-7H2,1,3H3/b5-4+ |
| InChIKey | KGFXOIRJEDXNOD-SNAWJCMRSA-N |
| XLogP | 2.85 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.12 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|