C13H23BrO2 — CID 134936737
(5E)-4-(2-bromo-1-ethoxyethoxy)nona-1,5-diene (PubChem CID 134936737) has the molecular formula C13H23BrO2 and a molecular weight of 291.23 g/mol. Its IUPAC name is (5E)-4-(2-bromo-1-ethoxyethoxy)nona-1,5-diene.
| Compound Name | (5E)-4-(2-bromo-1-ethoxyethoxy)nona-1,5-diene |
|---|---|
| PubChem CID | 134936737 |
| Molecular Formula | C13H23BrO2 |
| Molecular Weight | 291.23 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | (5E)-4-(2-bromo-1-ethoxyethoxy)nona-1,5-diene |
| SMILES | C=CCC(/C=C/CCC)OC(CBr)OCC |
| InChI | InChI=1S/C13H23BrO2/c1-4-7-8-10-12(9-5-2)16-13(11-14)15-6-3/h5,8,10,12-13H,2,4,6-7,9,11H2,1,3H3/b10-8+ |
| InChIKey | PFSIPMKKCQGXEU-CSKARUKUSA-N |
| XLogP | 4.06 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.23 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|